C11H20O2 — CID 59883477
(3S)-2-ethyl-4-methoxy-3-methyl-5-prop-2-enyloxolane (PubChem CID 59883477) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (3S)-2-ethyl-4-methoxy-3-methyl-5-prop-2-enyloxolane.
| Compound Name | (3S)-2-ethyl-4-methoxy-3-methyl-5-prop-2-enyloxolane |
|---|---|
| PubChem CID | 59883477 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (3S)-2-ethyl-4-methoxy-3-methyl-5-prop-2-enyloxolane |
| SMILES | C=CCC1OC(CC)[C@H](C)C1OC |
| InChI | InChI=1S/C11H20O2/c1-5-7-10-11(12-4)8(3)9(6-2)13-10/h5,8-11H,1,6-7H2,2-4H3/t8-,9?,10?,11?/m0/s1 |
| InChIKey | BEZFFKXJQUKEGQ-FBAUCUACSA-N |
| XLogP | 2.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|