C11H19O5S — CID 59883541
CID 59883541 (PubChem CID 59883541) has the molecular formula C11H19O5S and a molecular weight of 263.33 g/mol.
| Compound Name | CID 59883541 |
|---|---|
| PubChem CID | 59883541 |
| Molecular Formula | C11H19O5S |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | — |
| SMILES | CCOCCSCC(C[CH]C(=O)OC)C(=O)O |
| InChI | InChI=1S/C11H19O5S/c1-3-16-6-7-17-8-9(11(13)14)4-5-10(12)15-2/h5,9H,3-4,6-8H2,1-2H3,(H,13,14) |
| InChIKey | LXCYTGOJHUEQOY-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|