C21H32N8O4S — CID 59883673
N-[(2S)-5-(1-aminoethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-2-[(3S)-3-[3-(1-aminoethylideneamino)propyl]-2,5-dioxopiperazin-1-yl]acetamide (PubChem CID 59883673) has the molecular formula C21H32N8O4S and a molecular weight of 492.61 g/mol. Its IUPAC name is N-[(2S)-5-(1-aminoethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-2-[(3S)-3-[3-(1-aminoethylideneamino)propyl]-2,5-dioxopiperazin-1-yl]acetamide.
| Compound Name | N-[(2S)-5-(1-aminoethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-2-[(3S)-3-[3-(1-aminoethylideneamino)propyl]-2,5-dioxopiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 59883673 |
| Molecular Formula | C21H32N8O4S |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | N-[(2S)-5-(1-aminoethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-2-[(3S)-3-[3-(1-aminoethylideneamino)propyl]-2,5-dioxopiperazin-1-yl]acetamide |
| SMILES | C/C(N)=N\CCC[C@H](NC(=O)CN1CC(=O)N[C@@H](CCC/N=C(\C)N)C1=O)C(=O)c1nccs1 |
| InChI | InChI=1S/C21H32N8O4S/c1-13(22)24-7-3-5-15(19(32)20-26-9-10-34-20)27-17(30)11-29-12-18(31)28-16(21(29)33)6-4-8-25-14(2)23/h9-10,15-16H,3-8,11-12H2,1-2H3,(H2,22,24)(H2,23,25)(H,27,30)(H,28,31)/t15-,16-/m0/s1 |
| InChIKey | IEXOHYGWPVAMSI-HOTGVXAUSA-N |
| XLogP | -0.55 |
| TPSA | 185.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|