C17H36N2 — CID 59883896
N-ethyl-1,2,2,3,3,6,6,7,7-nonamethylazepan-4-amine (PubChem CID 59883896) has the molecular formula C17H36N2 and a molecular weight of 268.49 g/mol. Its IUPAC name is N-ethyl-1,2,2,3,3,6,6,7,7-nonamethylazepan-4-amine.
| Compound Name | N-ethyl-1,2,2,3,3,6,6,7,7-nonamethylazepan-4-amine |
|---|---|
| PubChem CID | 59883896 |
| Molecular Formula | C17H36N2 |
| Molecular Weight | 268.49 g/mol |
| Exact Mass | 268.29 |
| IUPAC Name | N-ethyl-1,2,2,3,3,6,6,7,7-nonamethylazepan-4-amine |
| SMILES | CCNC1CC(C)(C)C(C)(C)N(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C17H36N2/c1-11-18-13-12-14(2,3)16(6,7)19(10)17(8,9)15(13,4)5/h13,18H,11-12H2,1-10H3 |
| InChIKey | ZBTPSWSMERHARF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |