About (3S)-3-methyl-1,4-diazaspiro[4.4]nonane
(3S)-3-methyl-1,4-diazaspiro[4.4]nonane (PubChem CID 59883923) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is (3S)-3-methyl-1,4-diazaspiro[4.4]nonane.
Molecular Properties
| Compound Name | (3S)-3-methyl-1,4-diazaspiro[4.4]nonane |
| PubChem CID | 59883923 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (3S)-3-methyl-1,4-diazaspiro[4.4]nonane |
| SMILES | C[C@H]1CNC2(CCCC2)N1 |
| InChI | InChI=1S/C8H16N2/c1-7-6-9-8(10-7)4-2-3-5-8/h7,9-10H,2-6H2,1H3/t7-/m0/s1 |
| InChIKey | PECRVUZJCJBXMH-ZETCQYMHSA-N |
| XLogP | 0.84 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-methyl-1,4-diazaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-methyl-1,4-diazaspiro[4.4]nonane?
The IUPAC name of (3S)-3-methyl-1,4-diazaspiro[4.4]nonane (CID 59883923) is (3S)-3-methyl-1,4-diazaspiro[4.4]nonane.
What is the SMILES notation for (3S)-3-methyl-1,4-diazaspiro[4.4]nonane?
The canonical SMILES for (3S)-3-methyl-1,4-diazaspiro[4.4]nonane is C[C@H]1CNC2(CCCC2)N1.
What is the InChIKey of (3S)-3-methyl-1,4-diazaspiro[4.4]nonane?
The InChIKey is PECRVUZJCJBXMH-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H16N2/c1-7-6-9-8(10-7)4-2-3-5-8/h7,9-10H,2-6H2,1H3/t7-/m0/s1.
What are the key properties of (3S)-3-methyl-1,4-diazaspiro[4.4]nonane?
(3S)-3-methyl-1,4-diazaspiro[4.4]nonane has a molecular weight of 140.23 g/mol, XLogP of 0.84, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-methyl-1,4-diazaspiro[4.4]nonane is sourced from PubChem (CID 59883923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).