About (5S)-2,2-dimethyl-5-[(4-methylphenyl)methyl]imidazolidin-4-one
(5S)-2,2-dimethyl-5-[(4-methylphenyl)methyl]imidazolidin-4-one (PubChem CID 59884112) has the molecular formula C13H18N2O
and a molecular weight of 218.30 g/mol. Its IUPAC name is (5S)-2,2-dimethyl-5-[(4-methylphenyl)methyl]imidazolidin-4-one.
Molecular Properties
| Compound Name | (5S)-2,2-dimethyl-5-[(4-methylphenyl)methyl]imidazolidin-4-one |
| PubChem CID | 59884112 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | (5S)-2,2-dimethyl-5-[(4-methylphenyl)methyl]imidazolidin-4-one |
| SMILES | Cc1ccc(C[C@@H]2NC(C)(C)NC2=O)cc1 |
| InChI | InChI=1S/C13H18N2O/c1-9-4-6-10(7-5-9)8-11-12(16)15-13(2,3)14-11/h4-7,11,14H,8H2,1-3H3,(H,15,16)/t11-/m0/s1 |
| InChIKey | DZPKUEUZBRVUPX-NSHDSACASA-N |
| XLogP | 1.36 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-2,2-dimethyl-5-[(4-methylphenyl)methyl]imidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-2,2-dimethyl-5-[(4-methylphenyl)methyl]imidazolidin-4-one?
The IUPAC name of (5S)-2,2-dimethyl-5-[(4-methylphenyl)methyl]imidazolidin-4-one (CID 59884112) is (5S)-2,2-dimethyl-5-[(4-methylphenyl)methyl]imidazolidin-4-one.
What is the SMILES notation for (5S)-2,2-dimethyl-5-[(4-methylphenyl)methyl]imidazolidin-4-one?
The canonical SMILES for (5S)-2,2-dimethyl-5-[(4-methylphenyl)methyl]imidazolidin-4-one is Cc1ccc(C[C@@H]2NC(C)(C)NC2=O)cc1.
What is the InChIKey of (5S)-2,2-dimethyl-5-[(4-methylphenyl)methyl]imidazolidin-4-one?
The InChIKey is DZPKUEUZBRVUPX-NSHDSACASA-N. The full InChI is InChI=1S/C13H18N2O/c1-9-4-6-10(7-5-9)8-11-12(16)15-13(2,3)14-11/h4-7,11,14H,8H2,1-3H3,(H,15,16)/t11-/m0/s1.
What are the key properties of (5S)-2,2-dimethyl-5-[(4-methylphenyl)methyl]imidazolidin-4-one?
(5S)-2,2-dimethyl-5-[(4-methylphenyl)methyl]imidazolidin-4-one has a molecular weight of 218.30 g/mol, XLogP of 1.36, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-2,2-dimethyl-5-[(4-methylphenyl)methyl]imidazolidin-4-one is sourced from PubChem (CID 59884112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).