C16H20N2 — CID 59884125
(4S)-2,2-dimethyl-4-(naphthalen-2-ylmethyl)imidazolidine (PubChem CID 59884125) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is (4S)-2,2-dimethyl-4-(naphthalen-2-ylmethyl)imidazolidine.
| Compound Name | (4S)-2,2-dimethyl-4-(naphthalen-2-ylmethyl)imidazolidine |
|---|---|
| PubChem CID | 59884125 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | (4S)-2,2-dimethyl-4-(naphthalen-2-ylmethyl)imidazolidine |
| SMILES | CC1(C)NC[C@H](Cc2ccc3ccccc3c2)N1 |
| InChI | InChI=1S/C16H20N2/c1-16(2)17-11-15(18-16)10-12-7-8-13-5-3-4-6-14(13)9-12/h3-9,15,17-18H,10-11H2,1-2H3/t15-/m0/s1 |
| InChIKey | AABSYHSOUJDKJH-HNNXBMFYSA-N |
| XLogP | 2.68 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |