C13H23ClSi — CID 59884248
tert-butyl-chloro-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 59884248) has the molecular formula C13H23ClSi and a molecular weight of 242.87 g/mol. Its IUPAC name is tert-butyl-chloro-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | tert-butyl-chloro-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 59884248 |
| Molecular Formula | C13H23ClSi |
| Molecular Weight | 242.87 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | tert-butyl-chloro-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=C(C)C([SiH](Cl)C(C)(C)C)C(C)=C1C |
| InChI | InChI=1S/C13H23ClSi/c1-8-9(2)11(4)12(10(8)3)15(14)13(5,6)7/h12,15H,1-7H3 |
| InChIKey | INIIJXRMRGVTHZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.87 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|