C33H50O — CID 59884395
(4E,7aR)-4-[(2Z)-2-[(3S,5S)-3,5-dimethyl-2-methylidenecyclohexylidene]ethylidene]-1-[(E,2R)-5-methoxy-6,6-dimethylnon-3-en-7-yn-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-indene (PubChem CID 59884395) has the molecular formula C33H50O and a molecular weight of 462.76 g/mol. Its IUPAC name is (4E,7aR)-4-[(2Z)-2-[(3S,5S)-3,5-dimethyl-2-methylidenecyclohexylidene]ethylidene]-1-[(E,2R)-5-methoxy-6,6-dimethylnon-3-en-7-yn-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-indene.
| Compound Name | (4E,7aR)-4-[(2Z)-2-[(3S,5S)-3,5-dimethyl-2-methylidenecyclohexylidene]ethylidene]-1-[(E,2R)-5-methoxy-6,6-dimethylnon-3-en-7-yn-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-indene |
|---|---|
| PubChem CID | 59884395 |
| Molecular Formula | C33H50O |
| Molecular Weight | 462.76 g/mol |
| Exact Mass | 462.39 |
| IUPAC Name | (4E,7aR)-4-[(2Z)-2-[(3S,5S)-3,5-dimethyl-2-methylidenecyclohexylidene]ethylidene]-1-[(E,2R)-5-methoxy-6,6-dimethylnon-3-en-7-yn-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-indene |
| SMILES | C=C1/C(=C\C=C2/CCC[C@@]3(C)C2CCC3[C@H](C)/C=C/C(OC)C(C)(C)C#CC)C[C@@H](C)C[C@@H]1C |
| InChI | InChI=1S/C33H50O/c1-10-19-32(6,7)31(34-9)18-13-24(3)29-16-17-30-27(12-11-20-33(29,30)8)14-15-28-22-23(2)21-25(4)26(28)5/h13-15,18,23-25,29-31H,5,11-12,16-17,20-22H2,1-4,6-9H3/b18-13+,27-14+,28-15-/t23-,24+,25-,29?,30?,31?,33+/m0/s1 |
| InChIKey | GSGGRXZIFYYSFK-QWEDQTFHSA-N |
| XLogP | 8.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.76 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|