C30H27Cl2N3O5S2 — CID 59884415
(3Z)-1-[(3,4-dichlorophenyl)methyl]-3-(2,4-dioxo-1,3-thiazolidin-5-ylidene)-N-[2,6-di(propan-2-yl)phenyl]-2-oxoindole-5-sulfonamide (PubChem CID 59884415) has the molecular formula C30H27Cl2N3O5S2 and a molecular weight of 644.60 g/mol. Its IUPAC name is (3Z)-1-[(3,4-dichlorophenyl)methyl]-3-(2,4-dioxo-1,3-thiazolidin-5-ylidene)-N-[2,6-di(propan-2-yl)phenyl]-2-oxoindole-5-sulfonamide.
| Compound Name | (3Z)-1-[(3,4-dichlorophenyl)methyl]-3-(2,4-dioxo-1,3-thiazolidin-5-ylidene)-N-[2,6-di(propan-2-yl)phenyl]-2-oxoindole-5-sulfonamide |
|---|---|
| PubChem CID | 59884415 |
| Molecular Formula | C30H27Cl2N3O5S2 |
| Molecular Weight | 644.60 g/mol |
| Exact Mass | 643.08 |
| IUPAC Name | (3Z)-1-[(3,4-dichlorophenyl)methyl]-3-(2,4-dioxo-1,3-thiazolidin-5-ylidene)-N-[2,6-di(propan-2-yl)phenyl]-2-oxoindole-5-sulfonamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NS(=O)(=O)c1ccc2c(c1)/C(=C1/SC(=O)NC1=O)C(=O)N2Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C30H27Cl2N3O5S2/c1-15(2)19-6-5-7-20(16(3)4)26(19)34-42(39,40)18-9-11-24-21(13-18)25(27-28(36)33-30(38)41-27)29(37)35(24)14-17-8-10-22(31)23(32)12-17/h5-13,15-16,34H,14H2,1-4H3,(H,33,36,38)/b27-25- |
| InChIKey | UYLQWSBXCGFCQL-RFBIWTDZSA-N |
| XLogP | 7.28 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.60 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|