C8H16N2O2S — CID 59885096
(2S,3R)-3-hydroxy-2-methyl-3-[(2S,4S)-4-sulfanylpyrrolidin-2-yl]propanamide (PubChem CID 59885096) has the molecular formula C8H16N2O2S and a molecular weight of 204.30 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-methyl-3-[(2S,4S)-4-sulfanylpyrrolidin-2-yl]propanamide.
| Compound Name | (2S,3R)-3-hydroxy-2-methyl-3-[(2S,4S)-4-sulfanylpyrrolidin-2-yl]propanamide |
|---|---|
| PubChem CID | 59885096 |
| Molecular Formula | C8H16N2O2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-methyl-3-[(2S,4S)-4-sulfanylpyrrolidin-2-yl]propanamide |
| SMILES | C[C@H](C(N)=O)[C@@H](O)[C@@H]1C[C@H](S)CN1 |
| InChI | InChI=1S/C8H16N2O2S/c1-4(8(9)12)7(11)6-2-5(13)3-10-6/h4-7,10-11,13H,2-3H2,1H3,(H2,9,12)/t4-,5-,6-,7+/m0/s1 |
| InChIKey | RYELNHPMPVOWNQ-ZTYPAOSTSA-N |
| XLogP | -0.87 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|