C14H21ClN4O3 — CID 59885266
4-N-[(3aS,4R,6R,6aR)-6-(methoxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-6-chloropyrimidine-4,5-diamine (PubChem CID 59885266) has the molecular formula C14H21ClN4O3 and a molecular weight of 328.80 g/mol. Its IUPAC name is 4-N-[(3aS,4R,6R,6aR)-6-(methoxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-6-chloropyrimidine-4,5-diamine.
| Compound Name | 4-N-[(3aS,4R,6R,6aR)-6-(methoxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-6-chloropyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 59885266 |
| Molecular Formula | C14H21ClN4O3 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 4-N-[(3aS,4R,6R,6aR)-6-(methoxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-6-chloropyrimidine-4,5-diamine |
| SMILES | COC[C@H]1C[C@@H](Nc2ncnc(Cl)c2N)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C14H21ClN4O3/c1-14(2)21-10-7(5-20-3)4-8(11(10)22-14)19-13-9(16)12(15)17-6-18-13/h6-8,10-11H,4-5,16H2,1-3H3,(H,17,18,19)/t7-,8-,10-,11+/m1/s1 |
| InChIKey | ADHOQXMZCWVFQF-OYBPUVFXSA-N |
| XLogP | 1.68 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |