About (4,6-dimethyl-2-oxo-1-propan-2-yl-3-pyridinyl)azanide;tungsten
(4,6-dimethyl-2-oxo-1-propan-2-yl-3-pyridinyl)azanide;tungsten (PubChem CID 59885533) has the molecular formula C10H15N2OW-
and a molecular weight of 363.08 g/mol. Its IUPAC name is (4,6-dimethyl-2-oxo-1-propan-2-yl-3-pyridinyl)azanide;tungsten.
Molecular Properties
| Compound Name | (4,6-dimethyl-2-oxo-1-propan-2-yl-3-pyridinyl)azanide;tungsten |
| PubChem CID | 59885533 |
| Molecular Formula | C10H15N2OW- |
| Molecular Weight | 363.08 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | (4,6-dimethyl-2-oxo-1-propan-2-yl-3-pyridinyl)azanide;tungsten |
| SMILES | Cc1cc(C)n(C(C)C)c(=O)c1[NH-].[W] |
| InChI | InChI=1S/C10H15N2O.W/c1-6(2)12-8(4)5-7(3)9(11)10(12)13;/h5-6,11H,1-4H3;/q-1; |
| InChIKey | PXLLNMFXWOJZST-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 45.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.08 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4,6-dimethyl-2-oxo-1-propan-2-yl-3-pyridinyl)azanide;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,6-dimethyl-2-oxo-1-propan-2-yl-3-pyridinyl)azanide;tungsten?
The IUPAC name of (4,6-dimethyl-2-oxo-1-propan-2-yl-3-pyridinyl)azanide;tungsten (CID 59885533) is (4,6-dimethyl-2-oxo-1-propan-2-yl-3-pyridinyl)azanide;tungsten.
What is the SMILES notation for (4,6-dimethyl-2-oxo-1-propan-2-yl-3-pyridinyl)azanide;tungsten?
The canonical SMILES for (4,6-dimethyl-2-oxo-1-propan-2-yl-3-pyridinyl)azanide;tungsten is Cc1cc(C)n(C(C)C)c(=O)c1[NH-].[W].
What is the InChIKey of (4,6-dimethyl-2-oxo-1-propan-2-yl-3-pyridinyl)azanide;tungsten?
The InChIKey is PXLLNMFXWOJZST-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N2O.W/c1-6(2)12-8(4)5-7(3)9(11)10(12)13;/h5-6,11H,1-4H3;/q-1;.
What are the key properties of (4,6-dimethyl-2-oxo-1-propan-2-yl-3-pyridinyl)azanide;tungsten?
(4,6-dimethyl-2-oxo-1-propan-2-yl-3-pyridinyl)azanide;tungsten has a molecular weight of 363.08 g/mol, XLogP of 2.73, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4,6-dimethyl-2-oxo-1-propan-2-yl-3-pyridinyl)azanide;tungsten is sourced from PubChem (CID 59885533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).