About CID 59885752
CID 59885752 (PubChem CID 59885752) has the molecular formula C21H20BN3
and a molecular weight of 325.22 g/mol.
Molecular Properties
| Compound Name | CID 59885752 |
| PubChem CID | 59885752 |
| Molecular Formula | C21H20BN3 |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | — |
| SMILES | [B]N(C)c1ccc(/N=N/c2ccc3c(c2)CCCC3)c2ccccc12 |
| InChI | InChI=1S/C21H20BN3/c1-25(22)21-13-12-20(18-8-4-5-9-19(18)21)24-23-17-11-10-15-6-2-3-7-16(15)14-17/h4-5,8-14H,2-3,6-7H2,1H3/b24-23+ |
| InChIKey | AIMIBCCCLTVERO-WCWDXBQESA-N |
| XLogP | 5.65 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59885752 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59885752?
The IUPAC name of CID 59885752 (CID 59885752) is not available.
What is the SMILES notation for CID 59885752?
The canonical SMILES for CID 59885752 is [B]N(C)c1ccc(/N=N/c2ccc3c(c2)CCCC3)c2ccccc12.
What is the InChIKey of CID 59885752?
The InChIKey is AIMIBCCCLTVERO-WCWDXBQESA-N. The full InChI is InChI=1S/C21H20BN3/c1-25(22)21-13-12-20(18-8-4-5-9-19(18)21)24-23-17-11-10-15-6-2-3-7-16(15)14-17/h4-5,8-14H,2-3,6-7H2,1H3/b24-23+.
What are the key properties of CID 59885752?
CID 59885752 has a molecular weight of 325.22 g/mol, XLogP of 5.65, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59885752 is sourced from PubChem (CID 59885752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).