C21H34N4O4 — CID 59885903
(2R)-6-(carbamoylamino)-2-[[2,2-dimethyl-4-(4-methylphenyl)butanoyl]-methylamino]-N-hydroxyhexanamide (PubChem CID 59885903) has the molecular formula C21H34N4O4 and a molecular weight of 406.53 g/mol. Its IUPAC name is (2R)-6-(carbamoylamino)-2-[[2,2-dimethyl-4-(4-methylphenyl)butanoyl]-methylamino]-N-hydroxyhexanamide.
| Compound Name | (2R)-6-(carbamoylamino)-2-[[2,2-dimethyl-4-(4-methylphenyl)butanoyl]-methylamino]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 59885903 |
| Molecular Formula | C21H34N4O4 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | (2R)-6-(carbamoylamino)-2-[[2,2-dimethyl-4-(4-methylphenyl)butanoyl]-methylamino]-N-hydroxyhexanamide |
| SMILES | Cc1ccc(CCC(C)(C)C(=O)N(C)[C@H](CCCCNC(N)=O)C(=O)NO)cc1 |
| InChI | InChI=1S/C21H34N4O4/c1-15-8-10-16(11-9-15)12-13-21(2,3)19(27)25(4)17(18(26)24-29)7-5-6-14-23-20(22)28/h8-11,17,29H,5-7,12-14H2,1-4H3,(H,24,26)(H3,22,23,28)/t17-/m1/s1 |
| InChIKey | UEUYXWDWGWIGKK-QGZVFWFLSA-N |
| XLogP | 2.12 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|