C10H20N2 — CID 59885942
(2S,3R)-N,N,1,2,5-pentamethyl-3,6-dihydro-2H-pyridin-3-amine (PubChem CID 59885942) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is (2S,3R)-N,N,1,2,5-pentamethyl-3,6-dihydro-2H-pyridin-3-amine.
| Compound Name | (2S,3R)-N,N,1,2,5-pentamethyl-3,6-dihydro-2H-pyridin-3-amine |
|---|---|
| PubChem CID | 59885942 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | (2S,3R)-N,N,1,2,5-pentamethyl-3,6-dihydro-2H-pyridin-3-amine |
| SMILES | CC1=C[C@@H](N(C)C)[C@H](C)N(C)C1 |
| InChI | InChI=1S/C10H20N2/c1-8-6-10(11(3)4)9(2)12(5)7-8/h6,9-10H,7H2,1-5H3/t9-,10+/m0/s1 |
| InChIKey | NLRZWUWBGYNIDG-VHSXEESVSA-N |
| XLogP | 1.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|