C10H20N3W- — CID 59885952
(2R,3R)-2-N,2-N,3-N,3-N,1-pentamethyl-2,3,5,6-tetrahydropyridin-5-ide-2,3-diamine;tungsten (PubChem CID 59885952) has the molecular formula C10H20N3W- and a molecular weight of 366.13 g/mol. Its IUPAC name is (2R,3R)-2-N,2-N,3-N,3-N,1-pentamethyl-2,3,5,6-tetrahydropyridin-5-ide-2,3-diamine;tungsten.
| Compound Name | (2R,3R)-2-N,2-N,3-N,3-N,1-pentamethyl-2,3,5,6-tetrahydropyridin-5-ide-2,3-diamine;tungsten |
|---|---|
| PubChem CID | 59885952 |
| Molecular Formula | C10H20N3W- |
| Molecular Weight | 366.13 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (2R,3R)-2-N,2-N,3-N,3-N,1-pentamethyl-2,3,5,6-tetrahydropyridin-5-ide-2,3-diamine;tungsten |
| SMILES | CN(C)[C@@H]1C=[C-]CN(C)[C@H]1N(C)C.[W] |
| InChI | InChI=1S/C10H20N3.W/c1-11(2)9-7-6-8-13(5)10(9)12(3)4;/h7,9-10H,8H2,1-5H3;/q-1;/t9-,10-;/m1./s1 |
| InChIKey | PCUJBAXYTUUJQX-DHTOPLTISA-N |
| XLogP | 0.11 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.13 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|