About (2R,3S)-1,2,3,5-tetramethyl-3,4-dihydro-2H-pyridine
(2R,3S)-1,2,3,5-tetramethyl-3,4-dihydro-2H-pyridine (PubChem CID 59885958) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is (2R,3S)-1,2,3,5-tetramethyl-3,4-dihydro-2H-pyridine.
Analyze (2R,3S)-1,2,3,5-tetramethyl-3,4-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-1,2,3,5-tetramethyl-3,4-dihydro-2H-pyridine?
The IUPAC name of (2R,3S)-1,2,3,5-tetramethyl-3,4-dihydro-2H-pyridine (CID 59885958) is (2R,3S)-1,2,3,5-tetramethyl-3,4-dihydro-2H-pyridine.
What is the SMILES notation for (2R,3S)-1,2,3,5-tetramethyl-3,4-dihydro-2H-pyridine?
The canonical SMILES for (2R,3S)-1,2,3,5-tetramethyl-3,4-dihydro-2H-pyridine is CC1=CN(C)[C@H](C)[C@@H](C)C1.
What is the InChIKey of (2R,3S)-1,2,3,5-tetramethyl-3,4-dihydro-2H-pyridine?
The InChIKey is DUGUATDMMGSUFV-DTWKUNHWSA-N. The full InChI is InChI=1S/C9H17N/c1-7-5-8(2)9(3)10(4)6-7/h6,8-9H,5H2,1-4H3/t8-,9+/m0/s1.
What are the key properties of (2R,3S)-1,2,3,5-tetramethyl-3,4-dihydro-2H-pyridine?
(2R,3S)-1,2,3,5-tetramethyl-3,4-dihydro-2H-pyridine has a molecular weight of 139.24 g/mol, XLogP of 2.25, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-1,2,3,5-tetramethyl-3,4-dihydro-2H-pyridine is sourced from PubChem (CID 59885958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).