C16H20O3 — CID 59885970
(2R,5R)-5-cyclohexyl-2-methyl-5-phenyl-1,3-dioxolan-4-one (PubChem CID 59885970) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is (2R,5R)-5-cyclohexyl-2-methyl-5-phenyl-1,3-dioxolan-4-one.
| Compound Name | (2R,5R)-5-cyclohexyl-2-methyl-5-phenyl-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 59885970 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (2R,5R)-5-cyclohexyl-2-methyl-5-phenyl-1,3-dioxolan-4-one |
| SMILES | C[C@H]1OC(=O)[C@](c2ccccc2)(C2CCCCC2)O1 |
| InChI | InChI=1S/C16H20O3/c1-12-18-15(17)16(19-12,13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2,4-5,8-9,12,14H,3,6-7,10-11H2,1H3/t12-,16-/m0/s1 |
| InChIKey | VAIJSYLOBXMTEG-LRDDRELGSA-N |
| XLogP | 3.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |