About 4-methylpenta-1,3-dien-1-amine
4-methylpenta-1,3-dien-1-amine (PubChem CID 59886133) has the molecular formula C6H11N
and a molecular weight of 97.16 g/mol. Its IUPAC name is 4-methylpenta-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 4-methylpenta-1,3-dien-1-amine |
| PubChem CID | 59886133 |
| Molecular Formula | C6H11N |
| Molecular Weight | 97.16 g/mol |
| Exact Mass | 97.09 |
| IUPAC Name | 4-methylpenta-1,3-dien-1-amine |
| SMILES | CC(C)=CC=CN |
| InChI | InChI=1S/C6H11N/c1-6(2)4-3-5-7/h3-5H,7H2,1-2H3 |
| InChIKey | IVTWTMMWSNXMKG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.16 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpenta-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpenta-1,3-dien-1-amine?
The IUPAC name of 4-methylpenta-1,3-dien-1-amine (CID 59886133) is 4-methylpenta-1,3-dien-1-amine.
What is the SMILES notation for 4-methylpenta-1,3-dien-1-amine?
The canonical SMILES for 4-methylpenta-1,3-dien-1-amine is CC(C)=CC=CN.
What is the InChIKey of 4-methylpenta-1,3-dien-1-amine?
The InChIKey is IVTWTMMWSNXMKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N/c1-6(2)4-3-5-7/h3-5H,7H2,1-2H3.
What are the key properties of 4-methylpenta-1,3-dien-1-amine?
4-methylpenta-1,3-dien-1-amine has a molecular weight of 97.16 g/mol, XLogP of 1.42, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpenta-1,3-dien-1-amine is sourced from PubChem (CID 59886133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).