C24H40O2 — CID 59886600
[(1S,3R,7S,8S,8aR)-3,7,8a-trimethyl-8-(3-methylbutyl)-2,3,7,8-tetrahydro-1H-naphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 59886600) has the molecular formula C24H40O2 and a molecular weight of 360.58 g/mol. Its IUPAC name is [(1S,3R,7S,8S,8aR)-3,7,8a-trimethyl-8-(3-methylbutyl)-2,3,7,8-tetrahydro-1H-naphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [(1S,3R,7S,8S,8aR)-3,7,8a-trimethyl-8-(3-methylbutyl)-2,3,7,8-tetrahydro-1H-naphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59886600 |
| Molecular Formula | C24H40O2 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 360.30 |
| IUPAC Name | [(1S,3R,7S,8S,8aR)-3,7,8a-trimethyl-8-(3-methylbutyl)-2,3,7,8-tetrahydro-1H-naphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)O[C@H]1C[C@@H](C)C=C2C=C[C@H](C)[C@H](CCC(C)C)[C@]21C |
| InChI | InChI=1S/C24H40O2/c1-9-23(6,7)22(25)26-21-15-17(4)14-19-12-11-18(5)20(24(19,21)8)13-10-16(2)3/h11-12,14,16-18,20-21H,9-10,13,15H2,1-8H3/t17-,18-,20-,21-,24-/m0/s1 |
| InChIKey | GYIUBXYTJDZFKI-JHCRBYMJSA-N |
| XLogP | 6.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |