C7H14NS+ — CID 59886698
2,3,4,5-tetramethyl-4,5-dihydro-1,3-thiazol-3-ium (PubChem CID 59886698) has the molecular formula C7H14NS+ and a molecular weight of 144.26 g/mol. Its IUPAC name is 2,3,4,5-tetramethyl-4,5-dihydro-1,3-thiazol-3-ium.
| Compound Name | 2,3,4,5-tetramethyl-4,5-dihydro-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 59886698 |
| Molecular Formula | C7H14NS+ |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | 2,3,4,5-tetramethyl-4,5-dihydro-1,3-thiazol-3-ium |
| SMILES | CC1=[N+](C)C(C)C(C)S1 |
| InChI | InChI=1S/C7H14NS/c1-5-6(2)9-7(3)8(5)4/h5-6H,1-4H3/q+1 |
| InChIKey | YPBQZQFCRNWIFH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|