C22H26N4O2 — CID 59886883
3-(2-methylpyrimidin-5-yl)-9-(1,8-naphthyridin-2-yl)nonanoic acid (PubChem CID 59886883) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 3-(2-methylpyrimidin-5-yl)-9-(1,8-naphthyridin-2-yl)nonanoic acid.
| Compound Name | 3-(2-methylpyrimidin-5-yl)-9-(1,8-naphthyridin-2-yl)nonanoic acid |
|---|---|
| PubChem CID | 59886883 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 3-(2-methylpyrimidin-5-yl)-9-(1,8-naphthyridin-2-yl)nonanoic acid |
| SMILES | Cc1ncc(C(CCCCCCc2ccc3cccnc3n2)CC(=O)O)cn1 |
| InChI | InChI=1S/C22H26N4O2/c1-16-24-14-19(15-25-16)18(13-21(27)28)7-4-2-3-5-9-20-11-10-17-8-6-12-23-22(17)26-20/h6,8,10-12,14-15,18H,2-5,7,9,13H2,1H3,(H,27,28) |
| InChIKey | CINWOFULQPVZSC-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|