C12H24N2 — CID 59886899
N,N,1,2,3,5,6-heptamethyl-3,6-dihydro-2H-pyridin-4-amine (PubChem CID 59886899) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is N,N,1,2,3,5,6-heptamethyl-3,6-dihydro-2H-pyridin-4-amine.
| Compound Name | N,N,1,2,3,5,6-heptamethyl-3,6-dihydro-2H-pyridin-4-amine |
|---|---|
| PubChem CID | 59886899 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | N,N,1,2,3,5,6-heptamethyl-3,6-dihydro-2H-pyridin-4-amine |
| SMILES | CC1=C(N(C)C)C(C)C(C)N(C)C1C |
| InChI | InChI=1S/C12H24N2/c1-8-10(3)14(7)11(4)9(2)12(8)13(5)6/h8,10-11H,1-7H3 |
| InChIKey | UUJZSBFRWJJWTM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |