C13H25N — CID 59886905
1,2,3,5,6-pentamethyl-4-propan-2-yl-3,6-dihydro-2H-pyridine (PubChem CID 59886905) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is 1,2,3,5,6-pentamethyl-4-propan-2-yl-3,6-dihydro-2H-pyridine.
| Compound Name | 1,2,3,5,6-pentamethyl-4-propan-2-yl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 59886905 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 1,2,3,5,6-pentamethyl-4-propan-2-yl-3,6-dihydro-2H-pyridine |
| SMILES | CC1=C(C(C)C)C(C)C(C)N(C)C1C |
| InChI | InChI=1S/C13H25N/c1-8(2)13-9(3)11(5)14(7)12(6)10(13)4/h8-9,11-12H,1-7H3 |
| InChIKey | XTLRGAOWMKGJPN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|