C21H39O6P3 — CID 59887208
11-(diphosphanyloxy)-3,8,8,10,12,16-hexamethyl-7-phosphanyloxy-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 59887208) has the molecular formula C21H39O6P3 and a molecular weight of 480.46 g/mol. Its IUPAC name is 11-(diphosphanyloxy)-3,8,8,10,12,16-hexamethyl-7-phosphanyloxy-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 11-(diphosphanyloxy)-3,8,8,10,12,16-hexamethyl-7-phosphanyloxy-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 59887208 |
| Molecular Formula | C21H39O6P3 |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 11-(diphosphanyloxy)-3,8,8,10,12,16-hexamethyl-7-phosphanyloxy-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CC1CC2OC2(C)CCCC(C)C(OPP)C(C)C(=O)C(C)(C)C(OP)CC(=O)O1 |
| InChI | InChI=1S/C21H39O6P3/c1-12-8-7-9-21(6)16(25-21)10-13(2)24-17(22)11-15(26-28)20(4,5)19(23)14(3)18(12)27-30-29/h12-16,18,30H,7-11,28-29H2,1-6H3 |
| InChIKey | YHJJSTMMQOILNP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|