About N-[1-(7-chlorothieno[3,2-b]pyridin-2-yl)ethylidene]formamide
N-[1-(7-chlorothieno[3,2-b]pyridin-2-yl)ethylidene]formamide (PubChem CID 59887381) has the molecular formula C10H7ClN2OS
and a molecular weight of 238.70 g/mol. Its IUPAC name is N-[1-(7-chlorothieno[3,2-b]pyridin-2-yl)ethylidene]formamide.
Molecular Properties
| Compound Name | N-[1-(7-chlorothieno[3,2-b]pyridin-2-yl)ethylidene]formamide |
| PubChem CID | 59887381 |
| Molecular Formula | C10H7ClN2OS |
| Molecular Weight | 238.70 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | N-[1-(7-chlorothieno[3,2-b]pyridin-2-yl)ethylidene]formamide |
| SMILES | C/C(=N\C=O)c1cc2nccc(Cl)c2s1 |
| InChI | InChI=1S/C10H7ClN2OS/c1-6(13-5-14)9-4-8-10(15-9)7(11)2-3-12-8/h2-5H,1H3/b13-6+ |
| InChIKey | PLPBCQCASANJNV-AWNIVKPZSA-N |
| XLogP | 2.92 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.70 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(7-chlorothieno[3,2-b]pyridin-2-yl)ethylidene]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(7-chlorothieno[3,2-b]pyridin-2-yl)ethylidene]formamide?
The IUPAC name of N-[1-(7-chlorothieno[3,2-b]pyridin-2-yl)ethylidene]formamide (CID 59887381) is N-[1-(7-chlorothieno[3,2-b]pyridin-2-yl)ethylidene]formamide.
What is the SMILES notation for N-[1-(7-chlorothieno[3,2-b]pyridin-2-yl)ethylidene]formamide?
The canonical SMILES for N-[1-(7-chlorothieno[3,2-b]pyridin-2-yl)ethylidene]formamide is C/C(=N\C=O)c1cc2nccc(Cl)c2s1.
What is the InChIKey of N-[1-(7-chlorothieno[3,2-b]pyridin-2-yl)ethylidene]formamide?
The InChIKey is PLPBCQCASANJNV-AWNIVKPZSA-N. The full InChI is InChI=1S/C10H7ClN2OS/c1-6(13-5-14)9-4-8-10(15-9)7(11)2-3-12-8/h2-5H,1H3/b13-6+.
What are the key properties of N-[1-(7-chlorothieno[3,2-b]pyridin-2-yl)ethylidene]formamide?
N-[1-(7-chlorothieno[3,2-b]pyridin-2-yl)ethylidene]formamide has a molecular weight of 238.70 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(7-chlorothieno[3,2-b]pyridin-2-yl)ethylidene]formamide is sourced from PubChem (CID 59887381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).