About (4-methylidene-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-1-yl)methanol
(4-methylidene-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-1-yl)methanol (PubChem CID 59887412) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is (4-methylidene-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-1-yl)methanol.
Molecular Properties
| Compound Name | (4-methylidene-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-1-yl)methanol |
| PubChem CID | 59887412 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | (4-methylidene-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-1-yl)methanol |
| SMILES | C=C1OCCc2c1c[nH]c2CO |
| InChI | InChI=1S/C9H11NO2/c1-6-8-4-10-9(5-11)7(8)2-3-12-6/h4,10-11H,1-3,5H2 |
| InChIKey | NOGJILVLCLZDJY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 45.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-methylidene-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylidene-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-1-yl)methanol?
The IUPAC name of (4-methylidene-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-1-yl)methanol (CID 59887412) is (4-methylidene-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-1-yl)methanol.
What is the SMILES notation for (4-methylidene-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-1-yl)methanol?
The canonical SMILES for (4-methylidene-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-1-yl)methanol is C=C1OCCc2c1c[nH]c2CO.
What is the InChIKey of (4-methylidene-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-1-yl)methanol?
The InChIKey is NOGJILVLCLZDJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-6-8-4-10-9(5-11)7(8)2-3-12-6/h4,10-11H,1-3,5H2.
What are the key properties of (4-methylidene-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-1-yl)methanol?
(4-methylidene-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-1-yl)methanol has a molecular weight of 165.19 g/mol, XLogP of 1.05, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylidene-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-1-yl)methanol is sourced from PubChem (CID 59887412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).