C16H14ClFN2O5S — CID 59887653
2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluoro-N-methoxysulfinylbenzamide (PubChem CID 59887653) has the molecular formula C16H14ClFN2O5S and a molecular weight of 400.82 g/mol. Its IUPAC name is 2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluoro-N-methoxysulfinylbenzamide.
| Compound Name | 2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluoro-N-methoxysulfinylbenzamide |
|---|---|
| PubChem CID | 59887653 |
| Molecular Formula | C16H14ClFN2O5S |
| Molecular Weight | 400.82 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluoro-N-methoxysulfinylbenzamide |
| SMILES | COS(=O)NC(=O)c1cc(N2C(=O)C3=C(CCCC3)C2=O)c(F)cc1Cl |
| InChI | InChI=1S/C16H14ClFN2O5S/c1-25-26(24)19-14(21)10-6-13(12(18)7-11(10)17)20-15(22)8-4-2-3-5-9(8)16(20)23/h6-7H,2-5H2,1H3,(H,19,21) |
| InChIKey | YETNGWACFWZVCZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.82 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|