C15H16BrCl2N3O — CID 59887678
5-(4-bromo-5-ethyl-1-methylpyrazol-3-yl)-2,4-dichloro-N-ethylbenzamide (PubChem CID 59887678) has the molecular formula C15H16BrCl2N3O and a molecular weight of 405.12 g/mol. Its IUPAC name is 5-(4-bromo-5-ethyl-1-methylpyrazol-3-yl)-2,4-dichloro-N-ethylbenzamide.
| Compound Name | 5-(4-bromo-5-ethyl-1-methylpyrazol-3-yl)-2,4-dichloro-N-ethylbenzamide |
|---|---|
| PubChem CID | 59887678 |
| Molecular Formula | C15H16BrCl2N3O |
| Molecular Weight | 405.12 g/mol |
| Exact Mass | 402.99 |
| IUPAC Name | 5-(4-bromo-5-ethyl-1-methylpyrazol-3-yl)-2,4-dichloro-N-ethylbenzamide |
| SMILES | CCNC(=O)c1cc(-c2nn(C)c(CC)c2Br)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H16BrCl2N3O/c1-4-12-13(16)14(20-21(12)3)8-6-9(15(22)19-5-2)11(18)7-10(8)17/h6-7H,4-5H2,1-3H3,(H,19,22) |
| InChIKey | BSXHMTFRQYASIH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.12 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |