C19H30N4O6S2 — CID 59887730
4,7,21-trimethyl-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricosane-3,6,9,19,22-pentone (PubChem CID 59887730) has the molecular formula C19H30N4O6S2 and a molecular weight of 474.61 g/mol. Its IUPAC name is 4,7,21-trimethyl-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricosane-3,6,9,19,22-pentone.
| Compound Name | 4,7,21-trimethyl-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricosane-3,6,9,19,22-pentone |
|---|---|
| PubChem CID | 59887730 |
| Molecular Formula | C19H30N4O6S2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 4,7,21-trimethyl-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricosane-3,6,9,19,22-pentone |
| SMILES | CC1NC(=O)CC2CCCCSSCC(NC1=O)C(=O)NC(C)C(=O)NC(C)C(=O)O2 |
| InChI | InChI=1S/C19H30N4O6S2/c1-10-17(26)23-14-9-31-30-7-5-4-6-13(8-15(24)20-10)29-19(28)12(3)22-16(25)11(2)21-18(14)27/h10-14H,4-9H2,1-3H3,(H,20,24)(H,21,27)(H,22,25)(H,23,26) |
| InChIKey | NMZKINGVFNSDAK-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|