About 3-[5-[(2Z,4E)-6-methylhepta-2,4-dien-2-yl]tetrazol-1-yl]propanenitrile
3-[5-[(2Z,4E)-6-methylhepta-2,4-dien-2-yl]tetrazol-1-yl]propanenitrile (PubChem CID 59887957) has the molecular formula C12H17N5
and a molecular weight of 231.30 g/mol. Its IUPAC name is 3-[5-[(2Z,4E)-6-methylhepta-2,4-dien-2-yl]tetrazol-1-yl]propanenitrile.
Molecular Properties
| Compound Name | 3-[5-[(2Z,4E)-6-methylhepta-2,4-dien-2-yl]tetrazol-1-yl]propanenitrile |
| PubChem CID | 59887957 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 3-[5-[(2Z,4E)-6-methylhepta-2,4-dien-2-yl]tetrazol-1-yl]propanenitrile |
| SMILES | C/C(=C/C=C/C(C)C)c1nnnn1CCC#N |
| InChI | InChI=1S/C12H17N5/c1-10(2)6-4-7-11(3)12-14-15-16-17(12)9-5-8-13/h4,6-7,10H,5,9H2,1-3H3/b6-4+,11-7- |
| InChIKey | BJVURKDIWUWFLA-JWVBWWOWSA-N |
| XLogP | 2.20 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-[(2Z,4E)-6-methylhepta-2,4-dien-2-yl]tetrazol-1-yl]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-[(2Z,4E)-6-methylhepta-2,4-dien-2-yl]tetrazol-1-yl]propanenitrile?
The IUPAC name of 3-[5-[(2Z,4E)-6-methylhepta-2,4-dien-2-yl]tetrazol-1-yl]propanenitrile (CID 59887957) is 3-[5-[(2Z,4E)-6-methylhepta-2,4-dien-2-yl]tetrazol-1-yl]propanenitrile.
What is the SMILES notation for 3-[5-[(2Z,4E)-6-methylhepta-2,4-dien-2-yl]tetrazol-1-yl]propanenitrile?
The canonical SMILES for 3-[5-[(2Z,4E)-6-methylhepta-2,4-dien-2-yl]tetrazol-1-yl]propanenitrile is C/C(=C/C=C/C(C)C)c1nnnn1CCC#N.
What is the InChIKey of 3-[5-[(2Z,4E)-6-methylhepta-2,4-dien-2-yl]tetrazol-1-yl]propanenitrile?
The InChIKey is BJVURKDIWUWFLA-JWVBWWOWSA-N. The full InChI is InChI=1S/C12H17N5/c1-10(2)6-4-7-11(3)12-14-15-16-17(12)9-5-8-13/h4,6-7,10H,5,9H2,1-3H3/b6-4+,11-7-.
What are the key properties of 3-[5-[(2Z,4E)-6-methylhepta-2,4-dien-2-yl]tetrazol-1-yl]propanenitrile?
3-[5-[(2Z,4E)-6-methylhepta-2,4-dien-2-yl]tetrazol-1-yl]propanenitrile has a molecular weight of 231.30 g/mol, XLogP of 2.20, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-[(2Z,4E)-6-methylhepta-2,4-dien-2-yl]tetrazol-1-yl]propanenitrile is sourced from PubChem (CID 59887957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).