C12H19NO — CID 59887975
(3E,5E)-6-isocyanato-2,2-dimethylnona-3,5-diene (PubChem CID 59887975) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (3E,5E)-6-isocyanato-2,2-dimethylnona-3,5-diene.
| Compound Name | (3E,5E)-6-isocyanato-2,2-dimethylnona-3,5-diene |
|---|---|
| PubChem CID | 59887975 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (3E,5E)-6-isocyanato-2,2-dimethylnona-3,5-diene |
| SMILES | CCC/C(=C\C=C\C(C)(C)C)N=C=O |
| InChI | InChI=1S/C12H19NO/c1-5-7-11(13-10-14)8-6-9-12(2,3)4/h6,8-9H,5,7H2,1-4H3/b9-6+,11-8+ |
| InChIKey | HUBBHACFYPGLCC-DNLSTQPZSA-N |
| XLogP | 3.61 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|