C14H14N2O3S — CID 59888060
2-(2,3-dimethyl-4-oxo-1,3-thiazinan-5-yl)isoindole-1,3-dione (PubChem CID 59888060) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is 2-(2,3-dimethyl-4-oxo-1,3-thiazinan-5-yl)isoindole-1,3-dione.
| Compound Name | 2-(2,3-dimethyl-4-oxo-1,3-thiazinan-5-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 59888060 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 2-(2,3-dimethyl-4-oxo-1,3-thiazinan-5-yl)isoindole-1,3-dione |
| SMILES | CC1SCC(N2C(=O)c3ccccc3C2=O)C(=O)N1C |
| InChI | InChI=1S/C14H14N2O3S/c1-8-15(2)14(19)11(7-20-8)16-12(17)9-5-3-4-6-10(9)13(16)18/h3-6,8,11H,7H2,1-2H3 |
| InChIKey | GFKJBWHQQKECMN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|