C34H35N9O8 — CID 59888234
2-N,4-N-bis[4-[[3,5-bis(hydroperoxymethyl)phenyl]diazenyl]-3-methylphenyl]-6-methyl-1,3,5-triazine-2,4-diamine (PubChem CID 59888234) has the molecular formula C34H35N9O8 and a molecular weight of 697.71 g/mol. Its IUPAC name is 2-N,4-N-bis[4-[[3,5-bis(hydroperoxymethyl)phenyl]diazenyl]-3-methylphenyl]-6-methyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-bis[4-[[3,5-bis(hydroperoxymethyl)phenyl]diazenyl]-3-methylphenyl]-6-methyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 59888234 |
| Molecular Formula | C34H35N9O8 |
| Molecular Weight | 697.71 g/mol |
| Exact Mass | 697.26 |
| IUPAC Name | 2-N,4-N-bis[4-[[3,5-bis(hydroperoxymethyl)phenyl]diazenyl]-3-methylphenyl]-6-methyl-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1nc(Nc2ccc(/N=N/c3cc(COO)cc(COO)c3)c(C)c2)nc(Nc2ccc(/N=N/c3cc(COO)cc(COO)c3)c(C)c2)n1 |
| InChI | InChI=1S/C34H35N9O8/c1-20-8-27(4-6-31(20)42-40-29-12-23(16-48-44)10-24(13-29)17-49-45)37-33-35-22(3)36-34(39-33)38-28-5-7-32(21(2)9-28)43-41-30-14-25(18-50-46)11-26(15-30)19-51-47/h4-15,44-47H,16-19H2,1-3H3,(H2,35,36,37,38,39)/b42-40+,43-41+ |
| InChIKey | AXFNOFXTEVHKMS-IZRQRQPJSA-N |
| XLogP | 9.07 |
| TPSA | 230.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.71 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|