About 2-[2,5-dichloro-4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]carbamoyl]phenyl]sulfanylacetic acid
2-[2,5-dichloro-4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]carbamoyl]phenyl]sulfanylacetic acid (PubChem CID 59888558) has the molecular formula C15H17Cl2NO5S
and a molecular weight of 394.28 g/mol. Its IUPAC name is 2-[2,5-dichloro-4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]carbamoyl]phenyl]sulfanylacetic acid.
Molecular Properties
| Compound Name | 2-[2,5-dichloro-4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]carbamoyl]phenyl]sulfanylacetic acid |
| PubChem CID | 59888558 |
| Molecular Formula | C15H17Cl2NO5S |
| Molecular Weight | 394.28 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | 2-[2,5-dichloro-4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]carbamoyl]phenyl]sulfanylacetic acid |
| SMILES | CC(C)(C)OC(=O)CNC(=O)c1cc(Cl)c(SCC(=O)O)cc1Cl |
| InChI | InChI=1S/C15H17Cl2NO5S/c1-15(2,3)23-13(21)6-18-14(22)8-4-10(17)11(5-9(8)16)24-7-12(19)20/h4-5H,6-7H2,1-3H3,(H,18,22)(H,19,20) |
| InChIKey | FEKGZPNNAUBTJH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2,5-dichloro-4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]carbamoyl]phenyl]sulfanylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,5-dichloro-4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]carbamoyl]phenyl]sulfanylacetic acid?
The IUPAC name of 2-[2,5-dichloro-4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]carbamoyl]phenyl]sulfanylacetic acid (CID 59888558) is 2-[2,5-dichloro-4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]carbamoyl]phenyl]sulfanylacetic acid.
What is the SMILES notation for 2-[2,5-dichloro-4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]carbamoyl]phenyl]sulfanylacetic acid?
The canonical SMILES for 2-[2,5-dichloro-4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]carbamoyl]phenyl]sulfanylacetic acid is CC(C)(C)OC(=O)CNC(=O)c1cc(Cl)c(SCC(=O)O)cc1Cl.
What is the InChIKey of 2-[2,5-dichloro-4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]carbamoyl]phenyl]sulfanylacetic acid?
The InChIKey is FEKGZPNNAUBTJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17Cl2NO5S/c1-15(2,3)23-13(21)6-18-14(22)8-4-10(17)11(5-9(8)16)24-7-12(19)20/h4-5H,6-7H2,1-3H3,(H,18,22)(H,19,20).
What are the key properties of 2-[2,5-dichloro-4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]carbamoyl]phenyl]sulfanylacetic acid?
2-[2,5-dichloro-4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]carbamoyl]phenyl]sulfanylacetic acid has a molecular weight of 394.28 g/mol, XLogP of 3.24, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,5-dichloro-4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]carbamoyl]phenyl]sulfanylacetic acid is sourced from PubChem (CID 59888558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).