C8H16N4O — CID 59888708
[(3aS,4S)-1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrol-4-yl]methylurea (PubChem CID 59888708) has the molecular formula C8H16N4O and a molecular weight of 184.24 g/mol. Its IUPAC name is [(3aS,4S)-1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrol-4-yl]methylurea.
| Compound Name | [(3aS,4S)-1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrol-4-yl]methylurea |
|---|---|
| PubChem CID | 59888708 |
| Molecular Formula | C8H16N4O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | [(3aS,4S)-1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrol-4-yl]methylurea |
| SMILES | NC(=O)NC[C@H]1NCC2CNC[C@H]21 |
| InChI | InChI=1S/C8H16N4O/c9-8(13)12-4-7-6-3-10-1-5(6)2-11-7/h5-7,10-11H,1-4H2,(H3,9,12,13)/t5?,6-,7-/m1/s1 |
| InChIKey | ISDTXOLUKKCKBJ-JXBXZBNISA-N |
| XLogP | -1.54 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |