C8H17N3O2S — CID 59888711
N-[[(3aS,4S)-1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrol-4-yl]methyl]methanesulfonamide (PubChem CID 59888711) has the molecular formula C8H17N3O2S and a molecular weight of 219.31 g/mol. Its IUPAC name is N-[[(3aS,4S)-1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrol-4-yl]methyl]methanesulfonamide.
| Compound Name | N-[[(3aS,4S)-1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrol-4-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 59888711 |
| Molecular Formula | C8H17N3O2S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | N-[[(3aS,4S)-1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrol-4-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC[C@H]1NCC2CNC[C@H]21 |
| InChI | InChI=1S/C8H17N3O2S/c1-14(12,13)11-5-8-7-4-9-2-6(7)3-10-8/h6-11H,2-5H2,1H3/t6?,7-,8-/m1/s1 |
| InChIKey | BFQJVPJFQQBDSE-SPDVFEMOSA-N |
| XLogP | -1.66 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |