C25H26N2O4S — CID 59889068
3-acetyl-1-cyclopropyl-7-[(5Z)-5-ethoxyimino-6,7-dihydro-4H-1-benzothiophen-2-yl]-8-methoxyquinolin-4-one (PubChem CID 59889068) has the molecular formula C25H26N2O4S and a molecular weight of 450.56 g/mol. Its IUPAC name is 3-acetyl-1-cyclopropyl-7-[(5Z)-5-ethoxyimino-6,7-dihydro-4H-1-benzothiophen-2-yl]-8-methoxyquinolin-4-one.
| Compound Name | 3-acetyl-1-cyclopropyl-7-[(5Z)-5-ethoxyimino-6,7-dihydro-4H-1-benzothiophen-2-yl]-8-methoxyquinolin-4-one |
|---|---|
| PubChem CID | 59889068 |
| Molecular Formula | C25H26N2O4S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 3-acetyl-1-cyclopropyl-7-[(5Z)-5-ethoxyimino-6,7-dihydro-4H-1-benzothiophen-2-yl]-8-methoxyquinolin-4-one |
| SMILES | CCO/N=C1/CCc2sc(-c3ccc4c(=O)c(C(C)=O)cn(C5CC5)c4c3OC)cc2C1 |
| InChI | InChI=1S/C25H26N2O4S/c1-4-31-26-16-5-10-21-15(11-16)12-22(32-21)18-8-9-19-23(25(18)30-3)27(17-6-7-17)13-20(14(2)28)24(19)29/h8-9,12-13,17H,4-7,10-11H2,1-3H3/b26-16- |
| InChIKey | GWHBGBKVRICNEM-QQXSKIMKSA-N |
| XLogP | 5.16 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|