About 2,3-dibromo-5,6-dihydro-4H-1-benzothiophen-7-one
2,3-dibromo-5,6-dihydro-4H-1-benzothiophen-7-one (PubChem CID 59889175) has the molecular formula C8H6Br2OS
and a molecular weight of 310.01 g/mol. Its IUPAC name is 2,3-dibromo-5,6-dihydro-4H-1-benzothiophen-7-one.
Molecular Properties
| Compound Name | 2,3-dibromo-5,6-dihydro-4H-1-benzothiophen-7-one |
| PubChem CID | 59889175 |
| Molecular Formula | C8H6Br2OS |
| Molecular Weight | 310.01 g/mol |
| Exact Mass | 307.85 |
| IUPAC Name | 2,3-dibromo-5,6-dihydro-4H-1-benzothiophen-7-one |
| SMILES | O=C1CCCc2c1sc(Br)c2Br |
| InChI | InChI=1S/C8H6Br2OS/c9-6-4-2-1-3-5(11)7(4)12-8(6)10/h1-3H2 |
| InChIKey | NWPIFQZDQYSXJY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.01 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dibromo-5,6-dihydro-4H-1-benzothiophen-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dibromo-5,6-dihydro-4H-1-benzothiophen-7-one?
The IUPAC name of 2,3-dibromo-5,6-dihydro-4H-1-benzothiophen-7-one (CID 59889175) is 2,3-dibromo-5,6-dihydro-4H-1-benzothiophen-7-one.
What is the SMILES notation for 2,3-dibromo-5,6-dihydro-4H-1-benzothiophen-7-one?
The canonical SMILES for 2,3-dibromo-5,6-dihydro-4H-1-benzothiophen-7-one is O=C1CCCc2c1sc(Br)c2Br.
What is the InChIKey of 2,3-dibromo-5,6-dihydro-4H-1-benzothiophen-7-one?
The InChIKey is NWPIFQZDQYSXJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Br2OS/c9-6-4-2-1-3-5(11)7(4)12-8(6)10/h1-3H2.
What are the key properties of 2,3-dibromo-5,6-dihydro-4H-1-benzothiophen-7-one?
2,3-dibromo-5,6-dihydro-4H-1-benzothiophen-7-one has a molecular weight of 310.01 g/mol, XLogP of 3.79, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibromo-5,6-dihydro-4H-1-benzothiophen-7-one is sourced from PubChem (CID 59889175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).