C24H22N2O4S — CID 59889587
2-cyanoethyl 2-methyl-5,5-dioxo-4-phenyl-1,4,6,7-tetrahydro-[3]benzothiepino[5,4-b]pyridine-3-carboxylate (PubChem CID 59889587) has the molecular formula C24H22N2O4S and a molecular weight of 434.52 g/mol. Its IUPAC name is 2-cyanoethyl 2-methyl-5,5-dioxo-4-phenyl-1,4,6,7-tetrahydro-[3]benzothiepino[5,4-b]pyridine-3-carboxylate.
| Compound Name | 2-cyanoethyl 2-methyl-5,5-dioxo-4-phenyl-1,4,6,7-tetrahydro-[3]benzothiepino[5,4-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 59889587 |
| Molecular Formula | C24H22N2O4S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 2-cyanoethyl 2-methyl-5,5-dioxo-4-phenyl-1,4,6,7-tetrahydro-[3]benzothiepino[5,4-b]pyridine-3-carboxylate |
| SMILES | CC1=C(C(=O)OCCC#N)C(c2ccccc2)C2=C(N1)c1ccccc1CCS2(=O)=O |
| InChI | InChI=1S/C24H22N2O4S/c1-16-20(24(27)30-14-7-13-25)21(18-9-3-2-4-10-18)23-22(26-16)19-11-6-5-8-17(19)12-15-31(23,28)29/h2-6,8-11,21,26H,7,12,14-15H2,1H3 |
| InChIKey | NGHOIUDQCNWDLI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|