About 4-methyl-2-[2-(2,3,4-trifluorophenyl)ethyl]cyclohexan-1-one
4-methyl-2-[2-(2,3,4-trifluorophenyl)ethyl]cyclohexan-1-one (PubChem CID 59889693) has the molecular formula C15H17F3O
and a molecular weight of 270.29 g/mol. Its IUPAC name is 4-methyl-2-[2-(2,3,4-trifluorophenyl)ethyl]cyclohexan-1-one.
Molecular Properties
| Compound Name | 4-methyl-2-[2-(2,3,4-trifluorophenyl)ethyl]cyclohexan-1-one |
| PubChem CID | 59889693 |
| Molecular Formula | C15H17F3O |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 4-methyl-2-[2-(2,3,4-trifluorophenyl)ethyl]cyclohexan-1-one |
| SMILES | CC1CCC(=O)C(CCc2ccc(F)c(F)c2F)C1 |
| InChI | InChI=1S/C15H17F3O/c1-9-2-7-13(19)11(8-9)4-3-10-5-6-12(16)15(18)14(10)17/h5-6,9,11H,2-4,7-8H2,1H3 |
| InChIKey | XYSTVMHHAUMEOP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2-[2-(2,3,4-trifluorophenyl)ethyl]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-[2-(2,3,4-trifluorophenyl)ethyl]cyclohexan-1-one?
The IUPAC name of 4-methyl-2-[2-(2,3,4-trifluorophenyl)ethyl]cyclohexan-1-one (CID 59889693) is 4-methyl-2-[2-(2,3,4-trifluorophenyl)ethyl]cyclohexan-1-one.
What is the SMILES notation for 4-methyl-2-[2-(2,3,4-trifluorophenyl)ethyl]cyclohexan-1-one?
The canonical SMILES for 4-methyl-2-[2-(2,3,4-trifluorophenyl)ethyl]cyclohexan-1-one is CC1CCC(=O)C(CCc2ccc(F)c(F)c2F)C1.
What is the InChIKey of 4-methyl-2-[2-(2,3,4-trifluorophenyl)ethyl]cyclohexan-1-one?
The InChIKey is XYSTVMHHAUMEOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F3O/c1-9-2-7-13(19)11(8-9)4-3-10-5-6-12(16)15(18)14(10)17/h5-6,9,11H,2-4,7-8H2,1H3.
What are the key properties of 4-methyl-2-[2-(2,3,4-trifluorophenyl)ethyl]cyclohexan-1-one?
4-methyl-2-[2-(2,3,4-trifluorophenyl)ethyl]cyclohexan-1-one has a molecular weight of 270.29 g/mol, XLogP of 4.04, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-[2-(2,3,4-trifluorophenyl)ethyl]cyclohexan-1-one is sourced from PubChem (CID 59889693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).