C15H16F2O — CID 59889703
6,8-difluoro-2-methyl-3,4,4a,9,10,10a-hexahydro-2H-phenanthren-1-one (PubChem CID 59889703) has the molecular formula C15H16F2O and a molecular weight of 250.29 g/mol. Its IUPAC name is 6,8-difluoro-2-methyl-3,4,4a,9,10,10a-hexahydro-2H-phenanthren-1-one.
| Compound Name | 6,8-difluoro-2-methyl-3,4,4a,9,10,10a-hexahydro-2H-phenanthren-1-one |
|---|---|
| PubChem CID | 59889703 |
| Molecular Formula | C15H16F2O |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 6,8-difluoro-2-methyl-3,4,4a,9,10,10a-hexahydro-2H-phenanthren-1-one |
| SMILES | CC1CCC2c3cc(F)cc(F)c3CCC2C1=O |
| InChI | InChI=1S/C15H16F2O/c1-8-2-3-10-12(15(8)18)5-4-11-13(10)6-9(16)7-14(11)17/h6-8,10,12H,2-5H2,1H3 |
| InChIKey | FNXTUJYFHDNAFW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |