C16H24O3 — CID 59889924
(5S,8aS)-2,5,8a-trimethyl-5-(2-methylperoxyethyl)-4a,8-dihydro-4H-naphthalen-1-one (PubChem CID 59889924) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is (5S,8aS)-2,5,8a-trimethyl-5-(2-methylperoxyethyl)-4a,8-dihydro-4H-naphthalen-1-one.
| Compound Name | (5S,8aS)-2,5,8a-trimethyl-5-(2-methylperoxyethyl)-4a,8-dihydro-4H-naphthalen-1-one |
|---|---|
| PubChem CID | 59889924 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (5S,8aS)-2,5,8a-trimethyl-5-(2-methylperoxyethyl)-4a,8-dihydro-4H-naphthalen-1-one |
| SMILES | COOCC[C@@]1(C)C=CC[C@]2(C)C(=O)C(C)=CCC12 |
| InChI | InChI=1S/C16H24O3/c1-12-6-7-13-15(2,10-11-19-18-4)8-5-9-16(13,3)14(12)17/h5-6,8,13H,7,9-11H2,1-4H3/t13?,15-,16+/m1/s1 |
| InChIKey | PZOJYSSJUQPWPM-CZVYVAOFSA-N |
| XLogP | 3.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|