C33H51N2O6S+ — CID 59890343
(4R,5R)-3-butyl-5-[4-[2-[2-(4,4-dimethylpiperazin-4-ium-1-yl)ethoxy]ethoxy]phenyl]-3-ethyl-8-methoxy-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol (PubChem CID 59890343) has the molecular formula C33H51N2O6S+ and a molecular weight of 603.85 g/mol. Its IUPAC name is (4R,5R)-3-butyl-5-[4-[2-[2-(4,4-dimethylpiperazin-4-ium-1-yl)ethoxy]ethoxy]phenyl]-3-ethyl-8-methoxy-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol.
| Compound Name | (4R,5R)-3-butyl-5-[4-[2-[2-(4,4-dimethylpiperazin-4-ium-1-yl)ethoxy]ethoxy]phenyl]-3-ethyl-8-methoxy-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol |
|---|---|
| PubChem CID | 59890343 |
| Molecular Formula | C33H51N2O6S+ |
| Molecular Weight | 603.85 g/mol |
| Exact Mass | 603.35 |
| IUPAC Name | (4R,5R)-3-butyl-5-[4-[2-[2-(4,4-dimethylpiperazin-4-ium-1-yl)ethoxy]ethoxy]phenyl]-3-ethyl-8-methoxy-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol |
| SMILES | CCCCC1(CC)CS(=O)(=O)c2cc(OC)ccc2[C@@H](c2ccc(OCCOCCN3CC[N+](C)(C)CC3)cc2)[C@H]1O |
| InChI | InChI=1S/C33H51N2O6S/c1-6-8-15-33(7-2)25-42(37,38)30-24-28(39-5)13-14-29(30)31(32(33)36)26-9-11-27(12-10-26)41-23-22-40-21-18-34-16-19-35(3,4)20-17-34/h9-14,24,31-32,36H,6-8,15-23,25H2,1-5H3/q+1/t31-,32-,33?/m1/s1 |
| InChIKey | KPIUJTJHCKOUFA-NWBPNMJXSA-N |
| XLogP | 4.35 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.85 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|