C18H32O4 — CID 59890474
(5S)-2-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-5-hydroxy-2,4,6-trimethylnon-8-en-3-one (PubChem CID 59890474) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is (5S)-2-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-5-hydroxy-2,4,6-trimethylnon-8-en-3-one.
| Compound Name | (5S)-2-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-5-hydroxy-2,4,6-trimethylnon-8-en-3-one |
|---|---|
| PubChem CID | 59890474 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | (5S)-2-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-5-hydroxy-2,4,6-trimethylnon-8-en-3-one |
| SMILES | C=CCC(C)[C@H](O)C(C)C(=O)C(C)(C)[C@@H]1CCOC(C)(C)O1 |
| InChI | InChI=1S/C18H32O4/c1-8-9-12(2)15(19)13(3)16(20)17(4,5)14-10-11-21-18(6,7)22-14/h8,12-15,19H,1,9-11H2,2-7H3/t12?,13?,14-,15-/m0/s1 |
| InChIKey | FRPVJCQQXXCBSH-WUCCLRPBSA-N |
| XLogP | 3.33 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|