C15H17N2Pr- — CID 59890630
(6aR,9R,10aR)-9-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-7-ide;praseodymium (PubChem CID 59890630) has the molecular formula C15H17N2Pr- and a molecular weight of 366.22 g/mol. Its IUPAC name is (6aR,9R,10aR)-9-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-7-ide;praseodymium.
| Compound Name | (6aR,9R,10aR)-9-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-7-ide;praseodymium |
|---|---|
| PubChem CID | 59890630 |
| Molecular Formula | C15H17N2Pr- |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | (6aR,9R,10aR)-9-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-7-ide;praseodymium |
| SMILES | C[C@H]1C[N-][C@@H]2Cc3c[nH]c4cccc(c34)[C@H]2C1.[Pr] |
| InChI | InChI=1S/C15H17N2.Pr/c1-9-5-12-11-3-2-4-13-15(11)10(8-17-13)6-14(12)16-7-9;/h2-4,8-9,12,14,17H,5-7H2,1H3;/q-1;/t9-,12-,14-;/m1./s1 |
| InChIKey | OJGMUQFCRGSCRM-RIVLUAMXSA-N |
| XLogP | 3.59 |
| TPSA | 29.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |