C17H26O5 — CID 59890772
1-[(1aR,2S,2aR,3S,6aS,7Z,7aR)-2-hydroxy-7-(2-hydroxyethylidene)-7a-(hydroxymethyl)-3,6a-dimethyl-1a,2,2a,4,5,6-hexahydronaphtho[6,7-b]oxiren-3-yl]ethanone (PubChem CID 59890772) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is 1-[(1aR,2S,2aR,3S,6aS,7Z,7aR)-2-hydroxy-7-(2-hydroxyethylidene)-7a-(hydroxymethyl)-3,6a-dimethyl-1a,2,2a,4,5,6-hexahydronaphtho[6,7-b]oxiren-3-yl]ethanone.
| Compound Name | 1-[(1aR,2S,2aR,3S,6aS,7Z,7aR)-2-hydroxy-7-(2-hydroxyethylidene)-7a-(hydroxymethyl)-3,6a-dimethyl-1a,2,2a,4,5,6-hexahydronaphtho[6,7-b]oxiren-3-yl]ethanone |
|---|---|
| PubChem CID | 59890772 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 1-[(1aR,2S,2aR,3S,6aS,7Z,7aR)-2-hydroxy-7-(2-hydroxyethylidene)-7a-(hydroxymethyl)-3,6a-dimethyl-1a,2,2a,4,5,6-hexahydronaphtho[6,7-b]oxiren-3-yl]ethanone |
| SMILES | CC(=O)[C@@]1(C)CCC[C@]2(C)/C(=C/CO)[C@]3(CO)O[C@@H]3[C@@H](O)[C@@H]12 |
| InChI | InChI=1S/C17H26O5/c1-10(20)15(2)6-4-7-16(3)11(5-8-18)17(9-19)14(22-17)12(21)13(15)16/h5,12-14,18-19,21H,4,6-9H2,1-3H3/b11-5-/t12-,13-,14+,15+,16+,17-/m0/s1 |
| InChIKey | QXFKKNTWPKEASB-HOUYPESXSA-N |
| XLogP | 0.81 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|