C8H13N3O3RfY-2 — CID 59890949
1-ethyl-3-ethyl-6-hydroxy-5-methanidyl-1,3,5-triazinane-2,4-dione;rutherfordium;yttrium (PubChem CID 59890949) has the molecular formula C8H13N3O3RfY-2 and a molecular weight of 555.12 g/mol. Its IUPAC name is 1-ethyl-3-ethyl-6-hydroxy-5-methanidyl-1,3,5-triazinane-2,4-dione;rutherfordium;yttrium.
| Compound Name | 1-ethyl-3-ethyl-6-hydroxy-5-methanidyl-1,3,5-triazinane-2,4-dione;rutherfordium;yttrium |
|---|---|
| PubChem CID | 59890949 |
| Molecular Formula | C8H13N3O3RfY-2 |
| Molecular Weight | 555.12 g/mol |
| Exact Mass | 555.12 |
| IUPAC Name | 1-ethyl-3-ethyl-6-hydroxy-5-methanidyl-1,3,5-triazinane-2,4-dione;rutherfordium;yttrium |
| SMILES | [CH2-]CN1C(=O)N([CH2-])C(O)N(CC)C1=O.[Rf].[Y] |
| InChI | InChI=1S/C8H13N3O3.Rf.Y/c1-4-10-6(12)9(3)7(13)11(5-2)8(10)14;;/h7,13H,1,3-5H2,2H3;;/q-2;; |
| InChIKey | YHQYBGOFTJRUML-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.12 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|