C23H41NO4 — CID 59891448
(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-N-propylhept-5-enamide (PubChem CID 59891448) has the molecular formula C23H41NO4 and a molecular weight of 395.58 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-N-propylhept-5-enamide.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-N-propylhept-5-enamide |
|---|---|
| PubChem CID | 59891448 |
| Molecular Formula | C23H41NO4 |
| Molecular Weight | 395.58 g/mol |
| Exact Mass | 395.30 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-N-propylhept-5-enamide |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)NCCC)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C23H41NO4/c1-3-5-8-11-18(25)14-15-20-19(21(26)17-22(20)27)12-9-6-7-10-13-23(28)24-16-4-2/h6,9,14-15,18-22,25-27H,3-5,7-8,10-13,16-17H2,1-2H3,(H,24,28)/b9-6-,15-14+/t18-,19+,20+,21-,22+/m0/s1 |
| InChIKey | YBGCLLDDNMSEPH-YNRDDPJXSA-N |
| XLogP | 3.48 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.58 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|